Tài liệu đề thi thử thpt quốc gia môn hóa học số 15

  • Số trang: 18 |
  • Loại file: PDF |
  • Lượt xem: 386 |
  • Lượt tải: 0

Mô tả:

TRƯỜNG THPT NINH GIANG ĐỀ THI THỬ THPT QUỐC GIA LẦN I NĂM HỌC 2014 - 2015 Môn thi: Hóa học Thời gian làm bài: 90 phút (đề thi gồm 02 trang, 50 câu trắc nghiệm) Mã đề thi 132 Cho nguyên tử khối của một số nguyên tố: H=1, He=4, C=12, N=14, O=16, Li=7, Na=23, Mg=24, Al=27, S=32, Cl=35,5, K=39, Ca=40, Fe=56, Cu=64, Zn=65, Br=80, Ag=108, Ba=137. Câu 1: Số liên kết xichma (liên kế t đơn) có trong mô ̣t phân tử C nH2n+2 là A. 3n +2. B. 3n. C. 3n +1. D. 2n +2. Câu 2: Phát biểu nào sau đây đúng? A. Trong nguyên tử số proton luôn bằng số nơtron. B. Đồng vị là hiện tượng các nguyên tử có cùng số khối. C. Các tiểu phân Ar, K+, Cl- đều có cùng số ha ̣t mang điê ̣n tić h âm. D. Nước đá thuộc loại tinh thể nguyên tử. Câu 3: Khi nối thanh Fe với các kim loại sau: Zn, Al, Ni, Cu, Ag sau đó nhúng vào dung dịch H2SO4 loãng. Số trường hợp mà trong đó Fe bị ăn mòn trước là A. 2. B. 5. C. 4. D. 3. Câu 4: Đốt cháy hoàn toàn 0,1 mol chất hữu cơ X có công thức tổng quát CxHyO2 thu được không đến 17,92 lít CO2 (đktc). Để trung hoà 0,2 mol X cần 0,2 mol NaOH. Mặt khác cho 0,5 mol X tác dụng với Na dư thu được 0,5 mol H2. Số nguyên tử H có trong mô ̣t phân tử X là A. 6. B. 8. C. 10. D. 12. Câu 5: Cho 0,1 mol tristearin ((C17H35COO)3C3H5) tác dụng hoàn toàn với dung dịch NaOH dư, đun nóng, thu được m gam glixerol. Giá trị của m là A. 14,4. B. 9,2. C. 27,6. D. 4,6. Câu 6: Hỗn hơ ̣p X gồ m Na và Al 4C3 hoà tan vào nước chỉ thu được dung dịch Y và 3,36 lít khí C (đktc). Khố i lươ ̣ng Na tố i thiể u cầ n dùng là A. 0,15 gam. B. 2,76 gam. C. 0,69 gam. D. 4,02 gam. Câu 7: Tơ nitron (hay olon) được điều chế bằng phương pháp trùng hợp từ monome nào sau đây? A. CH2=CH-Cl. B. CH2=CH2. C. CH2=CH-CN. D. CH2=CH-CH3. Câu 8: Tiến hành phản ứng nhiệt nhôm hoàn toàn m gam hỗn hợp X gồm bột Al và FexOy trong điều kiện không có không khí thu được hỗn hợp Y. Nghiền nhỏ, trộn đều hỗn hợp Y rồi chia thành 2 phần: - Phần 1 có khối lượng 14,49 gam được hòa tan hết trong dung dịch HNO3 loãng, dư, đun nóng thu được dung dịch Z và 0,165 mol NO (sản phẩm khử duy nhất). - Phần 2 đem tác dụng với dung dịch NaOH dư đun nóng thu được 0,015 mol khí H2 và còn lại 2,52 gam chất rắn. Công thức của oxit sắt và giá trị của m lần lượt là A. FeO và 19,32. B. Fe3O4 và 19,32. C. Fe3O4 và 28,98. D. Fe2O3 và 28,98. Câu 9: Khi cho isopentan tác dụng với Br2 (as) theo tỷ lệ mol 1: 1 thu được sản phẩm chính là A. 1-brom-2-metylbutan. B. 2-brom-2-metylbutan. C. 2-brom-3-metylbutan. D. 1-brom-3-metylbutan. Câu 10: Cho m gam hỗn hợp X gồm Ba, BaO, Al vào nước dư phản ứng kết thúc được dung dịch Y; 3,024 lít khí (đktc) và 0,54 gam chất rắn không tan. Rót 110 ml dung dịch HCl 1M vào dung dịch Y được 5,46 gam kết tủa. Giá trị của m là: A. 8,74 gam. B. 7,21 gam. C. 8,58 gam. D. 8,2 gam. Câu 11: Cho các kết luận sau: (1) Đốt cháy hiđrocacbon thu được n H2O  n CO2 thì hiđrocacbon đó là ankan; (2) Đốt cháy hiđrocacbon thu được n H2O  n CO2 thì hiđrocacbon đó là anken; (3) Đốt cháy ankin thì được n H2O  n CO2 và nankin = n CO2 n H2O ; (4) Tất cả các ankin đều có thể tham gia phản ứng thế bởi AgNO3/NH3; (5) Tất cả các anken đối xứng đều có đồng phân hình học; (6) Anilin là chất lỏng, không màu, ít tan trong nước, nặng hơn nước. Để lâu trong không khí, anilin có nhuốm màu đen vì bị oxi hoá; >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 1/18 (7) Cao su buna có tính đàn hồi và độ bền tốt hơn cao su thiên nhiên; (8) Toluen và stiren đều làm mất màu dung dịch thuốc tím ở điều kiện thường. Trong các kết luận trên, số kết luận đúng là A. 6. B. 4. C. 5. D. 3. Câu 12: Khi giảm áp suấ t của hê ̣, cân bằ ng bi chuyể n di ch theo chiề u nghi ch ̣ ̣ ̣ là A. 2HI (k) H2 (k) + I2 (k) B. CaCO3 (r) CaO (r) + CO2 (k). C. FeO (r) + CO (k) Fe (r) + CO2 (k). D. 2SO2 (k) + O2 (k) 2SO3 (k). Câu 13: Đun nóng m gam chất hữu cơ (X) chứa C, H, O với 100 ml dung dịch NaOH 2M đến khi phản ứng xảy ra hoàn toàn. Để trung hòa lượng NaOH dư cần 40 ml dung dịch HCl 1M. Làm bay hơi cẩn thận dung dịch sau khi trung hòa, thu được 7,36 gam hỗn hợp 2 ancol đơn chức (Y), (Z) và 15,14 gam hỗn hợp 2 muối khan, trong đó có một muối của axit cacboxylic (T). Kết luận nào sau đây đúng? A. Chất hữu cơ X có chứa 14 nguyên tử hiđro. B. Ancol (Y) và (Z) là 2 chất đồng đẳng liên tiếp với nhau. C. Số nguyên tử cacbon trong axit (T) bằng một nửa số nguyên tử cacbon trong chất hữu cơ X. D. Axit (T) có chứa 2 liên kết đôi trong phân tử. Câu 14: Khí G được dùng để khử trùng cho nước sinh hoạt. Khí G là A. CO2. B. O2. C. Cl2. D. N2. Câu 15: Dãy nào dưới đây gồm tất các các chất không phản ứng với dung dich ̣ HNO 3 đặc nguội? A. Fe2O3, Fe, Cu. B. Fe, Cr, Al, Au. C. Al, Fe, Cr, Cu. D. Fe, Al, NaAlO2. Câu 16: Nhận xét nào sau đây sai? A. Glucozơ được dùng làm thuốc tăng lực cho người già, trẻ em, người ốm. B. Gỗ được dùng để chế biến thành giấy. C. Xenlulozơ có phản ứng màu với iot. D. Tinh bột là một trong số nguồn cung cấp năng lượng cho cơ thể. Câu 17: Tiến hành các thí nghiệm sau: (1) Sục khí etilen vào dung dịch KMnO4 loãng; (2) Cho hơi ancol etylic đi qua bột CuO nung nóng; (3) Sục khí etilen vào dung dịch Br2 trong CCl4; (4) Cho dung dịch glucozơ vào dung dịch AgNO3 trong NH3 dư, đun nóng; (5) Cho Fe3O4 vào dung dịch H2SO4 đặc, nóng; (6) Cho dung dịch HCl vào dung dịch Fe(NO3)2; (7) Cho FeS vào dung dịch HCl; (8) Cho Si vào dung dịch NaOH đặc, nóng. Trong các thí nghiệm trên, số thí nghiệm có xảy ra phản ứng oxi hóa - khử là A. 6. B. 5. C. 4. D. 7. Câu 18: Thủy phân hết một lượng pentapeptit T thu được 32,88 gam Ala-Gly-Ala-Gly; 10,85 gam Ala-GlyAla; 16,24 gam Ala-Gly-Gly; 26,28 gam Ala-Gly; 8,9 gam Alanin; còn lại là Glyxin và Gly-Gly với tỉ lệ mol tương ứng là 1:10. Tổng khối lượng Gly-Gly và Glyxin trong hỗn hợp sản phẩm là A. 28,80 gam. B. 25,11 gam. C. 27,90 gam. D. 34,875 gam. Câu 19: Hòa tan hỗn hợp X gồm Cu và Fe2O3 trong 400 ml dung dịch HCl aM thu được dung dịch Y và còn lại 1,0 gam Cu không tan. Nhúng thanh Mg vào dung dịch Y, sau khi phản ứng hoàn toàn nhấc thanh Mg ra thấy khối lượng tăng thêm 4,0 gam so với khối lượng thanh Mg ban đầu và có 1,12 lít khí H2 (đktc) thoát ra (giả thiết toàn bộ lượng kim loại thoát ra đều bám hết vào thanh Mg). Khối lượng Cu trong X và giá trị của a lần lượt là A. 3,2g gam và 0,75M. B. 4,2 gam và 1M. C. 4,2 gam và 0,75M. D. 3,2 gam và 2M. Câu 20: Hỗn hợp X gồm FeO, Fe2O3 và Fe3O4. Cho khí CO qua 7,12 gam X nung nóng, sau một thời gian thu được hỗn hợp chất rắn Y và hỗn hợp khí Z. Cho toàn bộ Z vào dung dịch Ba(OH) 2 dư, đến phản ứng hoàn toàn, thu được 7,88 gam kết tủa. Mặt khác, hòa tan hoàn toàn Y trong dung dịch H2SO4 đặc, nóng (dư), thu được 1,008 lít khí SO2 (đkc, sản phẩm khử duy nhất) và dung dịch chứa m gam muối. Giá trị của m là A. 36. B. 40. C. 20. D. 18. Câu 21: Đốt m gam hỗn hợp X gồm Fe, Cu, Mg, Zn trong oxi thu được 29,7 gam hỗn hợp chất rắn Y. Hòa tan hết Y bằng dung dịch HNO3 đặc nóng dư thu được 17,92 lit khí NO2 (đktc). Cho m gam hỗn hợp X tác dụng với dung dịch H2SO4 đặc, nóng, dư thu được dung dịch Z chứa 84,1 gam muối và khí SO2. Biết rằng NO2 và SO2 là các sản phẩm khử duy nhất của HNO3 và H2SO4. Giá trị của m là A. 23,3. B. 20,1. C. 26,5. D. 20,9. Câu 22: Có bao nhiêu nguyên tố hóa học mà nguyên tử của nó có electron cuối cùng điền vào phân lớp 4s? A. 9. B. 1. C. 2. D. 12. Câu 23: Hoà tan hoàn toàn 0,1 mol FeS2 trong dung dịch HNO3 đặc nóng. Thể tích khí NO2 bay ra (đktc) và số mol HNO3 (tối thiểu) phản ứng lầ n lươ ̣t là >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 2/18 A. 22,4 lít và 1,5 mol. B. 33,6 lít và 1,5 mol. C. 33,6 lít và 1,8 mol. D. 33,6 lít và 1,4 mol. Câu 24: Thực hiện phản ứng crackinh m gam isobutan thu được hỗn hợp X chỉ có các hiđrocacbon. Dẫn hỗn hợp X qua dung dịch chứa 6,4 gam brom, thấy brom phản ứng hết và có 4,704 lít hỗn hợp khí Y (đktc) thoát ra. Tỉ khối hơi của Y so với H2 là 117/7. Giá trị của m là A. 8,70. B. 9,28. C. 10,44. D. 8,12. Câu 25: Cho sơ đồ chuyển hóa sau (mỗi mũi tên là một phương trình phản ứng): Tinh bột → X → Y → Z → metyl axetat. Chất Y trong sơ đồ trên là A. C6H12O6. B. CH3OH. C. CH3COOH. D. C2H5OH. Câu 26: Cho 10,4 gam một hỗn hợp X gồm axit axetic và etyl axetat tác dụng vừa đủ với 150 gam dung dich ̣ NaOH 4%. %m của etyl axetat trong X là A. 42,3%. B. 57,7%. C. 88%. D. 22%. Câu 27: Khi oxi hóa 2,9 gam anđehit X ta thu được 4,5 gam axit cacboxylic tương ứng. Biết hiệu suất phản ứng là 100%. Vậy công thức của X là A. CH3CHO. B. CH2(CHO)2. C. OHC-CHO. D. C2H4(CHO)2. Câu 28: Hỗn hợp X gồm: HCHO, CH3COOH, HCOOCH3 và CH3CH(OH)COOH. Đốt cháy hoàn toàn hỗn hợp X cần V lít O2 (đktc) sau phản ứng thu được CO2 và H2O. Hấp thụ hết sản phẩm cháy vào nước vôi trong dư thu được 30 gam kết tủa. Vậy giá trị của V tương ứng là A. 5,60 lít. B. 8,40 lít. C. 7,84 lít. D. 6,72 lít. Câu 29: Glucozơ tác dụng được với tất cả các chất trong nhóm nào sau đây? A. H2 (đk thường), Cu(OH)2, O2. B. Na, CaCO3, H2 (Ni, to). C. Ag, CuO, CH3COOH. D. H2(Ni, to), Cu(OH)2 (trong nước), AgNO3 (NH3,to). Câu 30: Cho 2,74 gam Ba vào 100 ml dung dịch hỗn hợp HCl 0,2M và CuSO4 0,3M thu được m gam kết tủa. Giá trị của m là A. 1,96. B. 4,66. C. 2,94. D. 5,64. Câu 31: Cho dung dịch NaOH dư vào 100 ml dung dịch chứa đồng thời Ba(HCO3)2 0,5 M và BaCl2 0,4 M. Khố i lươ ̣ng kế t tủa thu đươ ̣c là A. 19,7 gam. B. 29,55 gam. C. 23,64 gam. D. 17,73 gam. Câu 32: Chất X có CTPT C4H8O2. Khi cho X tác dụng với ddNaOH (to) thì thu được chất Y có công thức C2H3O2Na. Công thức cấu tạo của chất X là A. C2H5COOCH3. B. CH3COOC2H5. C. HCOOC3H7. D. HCOOC3H5. Câu 33: Thực hiện các thí nghiệm sau: - Thí nghiệm 1: Trộn 0,015 mol ancol no X với 0,02 mol ancol no Y rồi cho hỗn hợp tác dụng hết với Na được 1,008 lít H2. - Thí nghiệm 2: Trộn 0,02 mol ancol X với 0,015 mol ancol Y rồi cho hỗn hợp tác dụng hết với Na được 0,952 lít H2. - Thí nghiệm 3: Đốt cháy hoàn toàn một lượng hỗn hợp ancol như trong thí nghiệm 1 thu được 6,21 gam hỗn hợp gồm CO2 và H2O. Biết thể tích các khi đo ở đktc và các ancol đều mạch hở. Công thức 2 ancol X và Y lần lượt là A. C2H4(OH)2 và C3H5(OH)3. B. C2H5OH và C3H7OH. C. C3H6(OH)2 và C3H5(OH)3. D. CH3OH và C2H5OH. Câu 34: Hỗn hợp X gồm 2 axit cacboxylic no, mạch hở. Đốt cháy hoàn toàn a mol hỗn hợp X thu được a mol H2O. Mặt khác, cho a mol hỗn hợp X tác dụng với NaHCO3 thu được 1,4a mol CO2. % khối lượng của axit có phân tử khối nhỏ hơn trong hỗn hợp X là A. 35,8%. B. 43,4%. C. 26,4%. D. 27,3%. Câu 35: Ứng dụng nào sau đây không phải của thạch cao nung (CaSO4.H2O)? A. Bó bột khi gẫy xương. B. Đúc khuôn. C. Thức ăn cho người và đô ̣ng vâ ̣t. D. Nă ̣n tươ ̣ng. Câu 36: Phát biểu nào sau đây là sai ? A. CaOCl2 là muối kép. B. Liên kết kim loại là liên kết được hình thành giữa các nguyên tử và ion kim loại trong mạng tinh thể do sự tham gia của các electron tự do. C. Supephotphat kép có thành phần chủ yếu là Ca(H2PO4)2. D. Trong các HX (X: halogen) thì HF có tính axit yếu nhất. >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 3/18 Câu 37: Cho 0,1 mol α-amino axit X tác dụng vừa đủ với 50 ml dung dịch HCl 2M. Trong một thí nghiệm khác, cho 26,7 gam X vào dung dịch HCl dư, sau đó cô cạn cẩn thận dung dịch thu được 37,65 gam muối khan. Vậy X là A. Alanin. B. Valin. C. Glyxin. D. Axit glutamic. Câu 38: Thể tích dd NaOH 2M tối thiểu để hấp thụ hết 5,6 lít khí CO2 (đktc) là A. 500 ml. B. 175 ml. C. 125 ml. D. 250 ml. Câu 39: Este nào sau đây có mùi thơm của hoa nhài ? A. etyl axetat. B. benzyl axetat. C. isoamyl axetat. D. phenyl axetat. Câu 40: Nhúng một lá sắt nhỏ vào dd chứa một trong những chất sau: FeCl3, AlCl3, CuSO4, Pb(NO3)2, NaCl, HNO3 (loãng, dư), H2SO4 (đặc, nóng, dư), NH4NO3, AgNO3 thiếu. Số trường hợp phản ứng tạo muối Fe(II) là A. 3. B. 4. C. 5. D. 6. Câu 41: Cho một đipeptit Y có công thức phân tử C6H12N2O3. Số đồng phân peptit của Y (chỉ chứa gốc αamino axit) mạch hở là A. 7. B. 5. C. 4. D. 6. Câu 42: Chấ t nào sau đây không tác dụng với dung dịch HCl? A. Al. B. KMnO4. C. Cu(OH)2. D. Ag. Câu 43: Dãy gồm tất cả các chất đều hoà tan trong dung dịch HCl dư là A. Mg, BaSO4, Fe3O4. B. Al(OH)3, AgCl, CuO. C. CuS, (NH4)2SO4, KOH. D. KMnO4, KCl, FeCO3. Câu 44: Cho các dung dich ̣ sau : NaHCO3, NaHSO4, AlCl3, Na3PO4, AgNO3, HNO3. Chất tác dụng được với nhiều chất nhất trong số các chất cho ở trên là A. HCl. B. BaCl2. C. H2SO4. D. NaOH. Câu 45: Có thể dùng NaOH (ở thể rắn) để làm khô các chất khí nào sau đây? A. NH3, O2, N2, CH4, H2. B. NH3, SO2, CO, Cl2. C. N2, NO2, CO2, CH4, H2. D. N2, Cl2, O2, CO2, H2. Câu 46: Cho hình vẽ như sau: dd H2SO4 đặc Hiện tượng xảy ra trong bình eclen chứa ddBr2 là A. Có kết tủa xuất hiện. B. Dung dịch Br2 bị mất màu. C. Vừa có kết tủa vừa mất màu dung dịch Br2. D. Không có phản ứng xảy ra. Na2SO3 dd Br2 tt Câu 47: Etylamin không có tính chất nào sau đây? A. Tác dụng với ddHCl. B. Tác dụng với ddFeCl3. C. Làm đổi màu quỳ tím ẩm. D. Tác dụng với CaCO3. Câu 48: Điện phân với điện cực trơ dung dịch chứa 0,3 mol AgNO3 bằng cường độ dòng điện 2,68 ampe, trong thời gian t giờ thu được dung dịch X. Cho 22,4 gam bột Fe vào dung dịch X thấy thoát ra khí NO (sản phẩm khử duy nhất) thu được 34,28 gam chất rắn. Các phản ứng xảy ra hoàn toàn. Giá trị của t là A. 1,25. B. 1,0. C. 1,2. D. 1,4. Câu 49: Phát biểu nào sau đây đúng? A. Tất cả các nguyên tố thuộc nhóm B đều là kim loại. B. Tất cả các nguyên tố thuộc nhóm A đều là kim loại. C. Nguyên tử các nguyên tố có 1, 2, 3 electron lớp ngoài cùng đều là kim loại. D. Nguyên tử các nguyên tố có 5, 6, 7 electron lớp ngoài cùng đều là kim loại. Câu 50: Trộn lẫn dung dịch có chứa 100 gam H3PO4 14,7% với dung dịch 16,8 gam KOH. Khối lượng muối thu được trong dung dịch là A. 28,8 gam. B. 31,5 gam. C. 26,1 gam. D. 14,7 gam. ----------- HẾT ---------- >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 4/18 FILE ĐỀ VÀ LỜI GIẢI CHI TIẾT Câu 1: Số liên kết xichma (liên kế t đơn) có trong mô ̣t phân tử C nH2n+2 là A. 3n +2. B. 3n. C. 3n +1. Giải: D. 2n +2. Có 2n + 2 liên kết đơn của H với C, thêm n-1 liên kết C-C => 3n+1 (hoặc thử một công thức ankan bất kì để suy ra đáp án) => Đáp án C Câu 2: Phát biểu nào sau đây đúng? A. Trong nguyên tử số proton luôn bằng số nơtron. B. Đồng vị là hiện tượng các nguyên tử có cùng số khối. C. Các tiểu phân Ar, K+, Cl- đều có cùng số ha ̣t mang điê ̣n tích âm. D. Nước đá thuộc loại tinh thể nguyên tử. Giải: ý A hiển nhiên sai ý B thiếu số notron khác nhau ý C đúng ý D sai, tinh thể phân tử => Đáp án C Câu 3: Khi nối thanh Fe với các kim loại sau: Zn, Al, Ni, Cu, Ag sau đó nhúng vào dung dịch H2SO4 loãng. Số trường hợp mà trong đó Fe bị ăn mòn trước là A. 2. B. 5. C. 4. D. 3. Giải: Fe sẽ bị ăn mòn trước nếu kim loại còn lại đứng sau Fe trong dãy điện hóa => Ni, Cu, Ag => Đáp án D Câu 4: Đốt cháy hoàn toàn 0,1 mol chất hữu cơ X có công thức tổng quát CxHyO2 thu được không đến 17,92 lít CO2 (đktc). Để trung hoà 0,2 mol X cần 0,2 mol NaOH. Mặt khác cho 0,5 mol X tác dụng với Na dư thu được 0,5 mol H2. Số nguyên tử H có trong mô ̣t phân tử X là A. 6. B. 8. C. 10. D. 12. Giải: Ta có nCO2 < 17.92/22.4 = 0.8 (mol) => x < 0.8/0.1 = 8 X có 2 oxi và trung hoà 0.2 mol X cần 0.2 mol NaOH => X là acid đơn chức, hoặc phenol đơn chức Mặt khác 0.5 mol X tác dụng với Na dư được 0.5 mol H2 => X gồm 1 nhóm -OH gắn trực tiếp trên vòng benzen và 1 nhóm -OH gắn trên nhánh. Như vậy X cần ít nhất 7 C (gồm 6 C của vòng benzen và 1 C của nhánh). mà số C nhỏ hơn 8. >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 5/18 Tóm lại CTCT của X là HOC6H4CH2OH Số H có trong X là 8 Câu 5: Cho 0,1 mol tristearin ((C17H35COO)3C3H5) tác dụng hoàn toàn với dung dịch NaOH dư, đun nóng, thu được m gam glixerol. Giá trị của m là A. 14,4. B. 9,2. C. 27,6. D. 4,6. Giải: Có 0,1 mol chất béo => tạo ra 0,1 mol glixerol => m = 0,1 . 92 = 9,2 gam => Đáp án B Câu 6: Hỗn hơ ̣p X gồ m Na và Al4C3 hoà tan vào nước chỉ thu đươ ̣c dung dich ̣ Y và 3,36 lít khí C (đktc). Khố i lươ ̣ng Na tố i thiể u cầ n dùng là A. 0,15 gam. B. 2,76 gam. C. 0,69 gam. D. 4,02 gam. Giải: Al4C3+12H2O--->3CH4+4Al(OH)3 ..........................3/4 mol...x mol Na + H2O ----> NaOH + 1/2H2 x mol...............x mol.....1/2x mol NaOH + Al(OH)3 -> NaAlO2 + 2H2O x mol.....x mol => 3/4x + 1/2x = 3.36/22.4=0,15 mol -> x= 0,12 mol -> m= 0,12 * 23 = 2,76g => Đáp án B Câu 7: Tơ nitron (hay olon) được điều chế bằng phương pháp trùng hợp từ monome nào sau đây? A. CH2=CH-Cl. B. CH2=CH2. C. CH2=CH-CN. D. CH2=CH-CH3. Giải: Monome tạo tơ nitron là CH2=CH-CN. => Đáp án C Câu 8: Tiến hành phản ứng nhiệt nhôm hoàn toàn m gam hỗn hợp X gồm bột Al và FexOy trong điều kiện không có không khí thu được hỗn hợp Y. Nghiền nhỏ, trộn đều hỗn hợp Y rồi chia thành 2 phần: - Phần 1 có khối lượng 14,49 gam được hòa tan hết trong dung dịch HNO3 loãng, dư, đun nóng thu được dung dịch Z và 0,165 mol NO (sản phẩm khử duy nhất). - Phần 2 đem tác dụng với dung dịch NaOH dư đun nóng thu được 0,015 mol khí H2 và còn lại 2,52 gam chất rắn. Công thức của oxit sắt và giá trị của m lần lượt là A. FeO và 19,32. B. Fe3O4 và 19,32. C. Fe3O4 và 28,98. D. Fe2O3 và 28,98. Giải: Phần 2 => mol Al = 0,01 ; mol Fe = 0,045 => tỉ lệ Al : Fe = 2/9 Đặt a, b, c là mol Al2O3 ; Al ; Fe 102a + 27b + 56c = 14,49 >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 6/18 3b + 3c = 0,165*3 9b - 2c = 0 => a = 0,06 ; b = 0,03 ; c = 0,135 => CT oxit sắt: Fe3O4 và phần 1 = 3*phầnPhần 2 => mol Al = 0,01 ; mol Fe = 0,045 => tỉ lệ Al : Fe = 2/9 Đặt a, b, c là mol Al2O3 ; Al ; Fe 102a + 27b + 56c = 14,49 3b + 3c = 0,165*3 9b - 2c = 0 => a = 0,06 ; b = 0,03 ; c = 0,135 => CT oxit sắt: Fe3O4 và phần 1 = 3*phần 2 => m = 19,32 2 => m = 19,32 => Đáp án B Câu 9: Khi cho isopentan tác dụng với Br2 (as) theo tỷ lệ mol 1: 1 thu được sản phẩm chính là A. 1-brom-2-metylbutan. B. 2-brom-2-metylbutan. C. 2-brom-3-metylbutan. D. 1-brom-3-metylbutan. Giải: isopentan có công thức C-C-C(C)-C tác dụng với brom tỉ lệ 1:! cho sản phẩm chính là (Br ưu tiên thế vào cacbon bậc cao nhất, tức vị trí Cacbon số 2) => 2-brom-2-metylbutan => Đáp án B Câu 10: Cho m gam hỗn hợp X gồm Ba, BaO, Al vào nước dư phản ứng kết thúc được dung dịch Y; 3,024 lít khí (đktc) và 0,54 gam chất rắn không tan. Rót 110 ml dung dịch HCl 1M vào dung dịch Y được 5,46 gam kết tủa. Giá trị của m là: A. 8,74 gam. B. 7,21 gam. C. 8,58 gam. D. 8,2 gam. Giải: Gọi x, y lần lượt là số mol Ba, BaO Hòa vào nước tạo 2.(x+y) mol OHAl còn dư suy ra số mol Al phản ứng bằng số mol OH- bằng 2(x+y)nH2 = nBa + 1,5nAl = x + 1,5.2.(x+y) = 0,135 (1) nHCl = 0,11 ta có công thức:3nKt + nH+ = 4nAlO2=> nAlO2- = 0,08 = n Al phản ứng = 2(x+y) (2) Từ (1,2) => x=0,015=Ba; y=0,025=BaO Al phản ứng=0,08 m = Ba + BaO + Al pư + Al dư = 8,58g => Đáp án C Câu 11: Cho các kết luận sau: (1) Đốt cháy hiđrocacbon thu được n H2O  n CO2 thì hiđrocacbon đó là ankan; >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 7/18 (2) Đốt cháy hiđrocacbon thu được n H2O  n CO2 thì hiđrocacbon đó là anken; (3) Đốt cháy ankin thì được n H2O  n CO2 và nankin = n CO2 n H2O ; (4) Tất cả các ankin đều có thể tham gia phản ứng thế bởi AgNO3/NH3; (5) Tất cả các anken đối xứng đều có đồng phân hình học; (6) Anilin là chất lỏng, không màu, ít tan trong nước, nặng hơn nước. Để lâu trong không khí, anilin có nhuốm màu đen vì bị oxi hoá; (7) Cao su buna có tính đàn hồi và độ bền tốt hơn cao su thiên nhiên; (8) Toluen và stiren đều làm mất màu dung dịch thuốc tím ở điều kiện thường. Trong các kết luận trên, số kết luận đúng là A. 6. B. 4. C. 5. D. 3. Giải: Các kết luận đúng là 1, 6, 7 => Đáp án D Câu 12: Khi giảm áp suấ t của hê ̣, cân bằ ng bi ̣chuyể n dich ̣ theo chiề u nghich ̣ là A. 2HI (k) H2 (k) + I2 (k) B. CaCO3 (r) CaO (r) + CO2 (k). C. FeO (r) + CO (k) Fe (r) + CO2 (k). D. 2SO2 (k) + O2 (k) 2SO3 (k). Giải: Giảm áp suất mà cân bằng dịch chuyển theo chiều nghịch => chiều nghịch tạo ra nhiều số mol khí hơn => Đáp án D Câu 13: Đun nóng m gam chất hữu cơ (X) chứa C, H, O với 100 ml dung dịch NaOH 2M đến khi phản ứng xảy ra hoàn toàn. Để trung hòa lượng NaOH dư cần 40 ml dung dịch HCl 1M. Làm bay hơi cẩn thận dung dịch sau khi trung hòa, thu được 7,36 gam hỗn hợp 2 ancol đơn chức (Y), (Z) và 15,14 gam hỗn hợp 2 muối khan, trong đó có một muối của axit cacboxylic (T). Kết luận nào sau đây đúng? A. Chất hữu cơ X có chứa 14 nguyên tử hiđro. B. Ancol (Y) và (Z) là 2 chất đồng đẳng liên tiếp với nhau. C. Số nguyên tử cacbon trong axit (T) bằng một nửa số nguyên tử cacbon trong chất hữu cơ X. D. Axit (T) có chứa 2 liên kết đôi trong phân tử. Giải: X phải chứa 2 nhóm -COOH, muối tạo bởi phản ứng của X với NaOH là R(COONa)2 (R- có thể không phải gốc hidrocacbon, nó có thể chứa C, H, O) mR(COONa)2 = m muối - mNaCl = 15,14 - 0,04.58,5 = 12,8 gam nNaOH =0,2-0,04= 0,16(mol) --> n muối =0,08 =>(R+134).0,08= 12,8 -> R= 26 (C2H2) + Từ khối lượng 2 ancol--> R1+R2 =58 Nghiệm thỏa là: R1=15 ; R2=43 X là: CH3OOC-CH=CH-COOCH2-CH2-CH3 Từ đây ta có A, B D đều sai => Đáp án C Câu 14: Khí G được dùng để khử trùng cho nước sinh hoa ̣t. Khí G là A. CO2. B. O2. C. Cl2. Giải: D. N2. Khử trùng nước, diệt khuẩn chỉ có Cl2 >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 8/18 => đáp án C Câu 15: Dãy nào dưới đây gồm tất các các chất không phản ứng với dung dich ̣ HNO 3 đặc nguội? A. Fe2O3, Fe, Cu. B. Fe, Cr, Al, Au. C. Al, Fe, Cr, Cu. D. Fe, Al, NaAlO2. Các chất không phản ứng là Fe, Cr, Al (bị thụ động hóa) và Au không phản ứng với HNO3 => Đáp án B Câu 16: Nhận xét nào sau đây sai? A. Glucozơ được dùng làm thuốc tăng lực cho người già, trẻ em, người ốm. B. Gỗ được dùng để chế biến thành giấy. C. Xenlulozơ có phản ứng màu với iot. D. Tinh bột là một trong số nguồn cung cấp năng lượng cho cơ thể. Giải: Xenlulozơ có phản ứng màu với iot sai vì chỉ có tinh bột mới có tính chất này => Đáp án C Câu 17: Tiến hành các thí nghiệm sau: (1) Sục khí etilen vào dung dịch KMnO4 loãng; (2) Cho hơi ancol etylic đi qua bột CuO nung nóng; (3) Sục khí etilen vào dung dịch Br2 trong CCl4; (4) Cho dung dịch glucozơ vào dung dịch AgNO3 trong NH3 dư, đun nóng; (5) Cho Fe3O4 vào dung dịch H2SO4 đặc, nóng; (6) Cho dung dịch HCl vào dung dịch Fe(NO3)2; (7) Cho FeS vào dung dịch HCl; (8) Cho Si vào dung dịch NaOH đặc, nóng. Trong các thí nghiệm trên, số thí nghiệm có xảy ra phản ứng oxi hóa - khử là A. 6. B. 5. C. 4. D. 7. Giải: Các thí nghiệm xảy ra phản ứng oxi hóa khử là 1 -2 - 3 - 4 - 5 - 6 - 8 => Đáp án Câu 18: Thủy phân hết một lượng pentapeptit T thu được 32,88 gam Ala-Gly-Ala-Gly; 10,85 gam Ala-GlyAla; 16,24 gam Ala-Gly-Gly; 26,28 gam Ala-Gly; 8,9 gam Alanin; còn lại là Glyxin và Gly-Gly với tỉ lệ mol tương ứng là 1:10. Tổng khối lượng Gly-Gly và Glyxin trong hỗn hợp sản phẩm là A. 28,80 gam. B. 25,11 gam. C. 27,90 gam. D. 34,875 gam. Giải: nAla–Gly–Ala–Gly = 0,12 mol nAla–Gly–Ala = 0,05 mol nAla–Gly–Gly = 0,08 mol nAla–Gly = 0,18 mil nAlanin = 0,1 mol nGly–Gly = 10x mol Glyxin = x mol Ta có: pentapeptit là : Ala–Gly–Ala–Gly-Gly :a mol bảo toàn: Gly: 3a = 0,12*2 + 0,05 + 0,08*2 + 0,18 + 21x (1) Ala : 2a = 0,12*2 + 0.05*2 + 0,08 + 0,18 + 0,1 = 0,7=> a = 0,35. >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 9/18 Thay vào 1 = > x =0,02 mol Vậy tổng m Gly-Gly và Gly là: 0,2*132 + 0,02*75 =27,9 (g) => Đáp án C Câu 19: Hòa tan hỗn hợp X gồm Cu và Fe2O3 trong 400 ml dung dịch HCl aM thu được dung dịch Y và còn lại 1,0 gam Cu không tan. Nhúng thanh Mg vào dung dịch Y, sau khi phản ứng hoàn toàn nhấc thanh Mg ra thấy khối lượng tăng thêm 4,0 gam so với khối lượng thanh Mg ban đầu và có 1,12 lít khí H2 (đktc) thoát ra (giả thiết toàn bộ lượng kim loại thoát ra đều bám hết vào thanh Mg). Khối lượng Cu trong X và giá trị của a lần lượt là A. 3,2g gam và 0,75M. B. 4,2 gam và 1M. C. 4,2 gam và 0,75M. D. 3,2 gam và 2M. Giải: Từ Mg + Cu2+ ->Mg2+ + Cu x x => m(tăng) = 40x Mg + 2H+ ->Mg2+ + H2 0,05 0,05 Mg + Fe2+ -> Mg2+ + Fe => m(tăng) = 32.2x 2x 2x 2x ->m(Mgtăng) = 40x + 64x - 1,2 = 4 -> x = 0,05mol ->m(Cu) = 3,2 gam Lại có Fe2O3 + 6H+ ->2Fe3+ + 3H2O x 6x 2x Cu +2Fe3+->2Fe2+ + Cu2+ x 2x 2x -> a = 6.0,05:0,4 = 0,75M => Đáp án A Câu 20: Hỗn hợp X gồm FeO, Fe2O3 và Fe3O4. Cho khí CO qua 7,12 gam X nung nóng, sau một thời gian thu được hỗn hợp chất rắn Y và hỗn hợp khí Z. Cho toàn bộ Z vào dung dịch Ba(OH)2 dư, đến phản ứng hoàn toàn, thu được 7,88 gam kết tủa. Mặt khác, hòa tan hoàn toàn Y trong dung dịch H2SO4 đặc, nóng (dư), thu được 1,008 lít khí SO2 (đkc, sản phẩm khử duy nhất) và dung dịch chứa m gam muối. Giá trị của m là A. 36. B. 40. C. 20. D. 18. Giải: Ta có nCO = 0,04 mol Quy đổi X về a mol Fe và b mol O, ta có: 56a + 16b = 7,12 và 3a = 2(b-0,04) + 0,045.2 => a = 0,09 và b = 0,13 Muối thu được là Fe2(SO4)3 có số mol 0,045 >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 10/18 => m = 18 => Đáp án D Câu 21: Đốt m gam hỗn hợp X gồm Fe, Cu, Mg, Zn trong oxi thu được 29,7 gam hỗn hợp chất rắn Y. Hòa tan hết Y bằng dung dịch HNO3 đặc nóng dư thu được 17,92 lit khí NO2 (đktc). Cho m gam hỗn hợp X tác dụng với dung dịch H2SO4 đặc, nóng, dư thu được dung dịch Z chứa 84,1 gam muối và khí SO2. Biết rằng NO2 và SO2 là các sản phẩm khử duy nhất của HNO3 và H2SO4. Giá trị của m là A. 23,3. B. 20,1. C. 26,5. D. 20,9. Giải: Ta có số mol e kim loại nhường là (19,7 - m)/8 + 0,8 Ta có số mol e nhận tạo khi SO2 là (19,7 -m)/8 + 0,8 => Số mol SO2 là (29,7 - m)/16 + 0,4 Trong phản ứng với H2SO4 đặc, ta có số mol H2SO4 = số mol H2O = 2 số mol SO2 Áp dụng bảo toàn khối lượng => m = 26,5 => Đáp án C Câu 22: Có bao nhiêu nguyên tố hóa học mà nguyên tử của nó có electron cuối cùng điền vào phân lớp 4s? A. 9. B. 1. C. 2. D. 12. Giải: Chỉ có K và Ca, còn lại các nguyên tố nhóm B đều có e cuối điền vào 3d chứ không phải 4s => Đáp án C Câu 23: Hoà tan hoàn toàn 0,1 mol FeS2 trong dung dịch HNO3 đặc nóng. Thể tích khí NO2 bay ra (đktc) và số mol HNO3 (tối thiểu) phản ứng lầ n lươ ̣t là A. 22,4 lít và 1,5 mol. B. 33,6 lít và 1,5 mol. C. 33,6 lít và 1,8 mol. D. 33,6 lít và 1,4 mol. Giải: Vì Fe lên +3 và S lên +6 nên số mol e cho sẽ là 1,5 mol => Số mol khí sẽ là 1,5 mol (33,6 lít) và số mol HNO3 = 1,5 mol (tạo khí) + 0,3 mol trong muối sắt => Đáp án C Câu 24: Thực hiện phản ứng crackinh m gam isobutan thu được hỗn hợp X chỉ có các hiđrocacbon. Dẫn hỗn hợp X qua dung dịch chứa 6,4 gam brom, thấy brom phản ứng hết và có 4,704 lít hỗn hợp khí Y (đktc) thoát ra. Tỉ khối hơi của Y so với H2 là 117/7. Giá trị của m là A. 8,70. B. 9,28. C. 10,44. D. 8,12. Giải: C4H10 -> C3H6 + CH4 -x--------x------x C4H10 dư Sau khi tác dụng với Br2 thì C3H6 còn lại là nC3H6=(x-0.04)mol Ta có 58(x+y)= m Ta lại có (58y + 42(x -0.04) + 16x)/0.21 = 117*2/7 >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 11/18 => 58(x + y) = 8.7 = m => Đáp án A Câu 25: Cho sơ đồ chuyển hóa sau (mỗi mũi tên là một phương trình phản ứng): Tinh bột → X → Y → Z → metyl axetat. Chất Y trong sơ đồ trên là A. C6H12O6. B. CH3OH. C. CH3COOH. D. C2H5OH. Giải: X là C6H12O6 Y là C2H5OH (phản ứng lên men rượu) => Đáp án D Câu 26: Cho 10,4 gam một hỗn hợp X gồm axit axetic và etyl axetat tác dụng vừa đủ với 150 gam dung dich ̣ NaOH 4%. %m của etyl axetat trong X là A. 42,3%. B. 57,7%. C. 88%. D. 22%. Giải: Gọi số mol của CH3COOH và CH3COOC2H5 là x, y CH3COOH + NaOH -> CH3COONa CH3COOC2H5 + NaOH -> CH3COONa + C2H5OH. NNaOH = 150.4/(100.40) = 0,15 (mol). Ta có hệ phương trình : x + y = 0,15 và 60x + 88y = 10,4 => x = 0,1 ; y = 0,05. %metyl axetat = 0,05.88 : 10,4 = 42,3%. => Đáp án A Câu 27: Khi oxi hóa 2,9 gam anđehit X ta thu được 4,5 gam axit cacboxylic tương ứng. Biết hiệu suất phản ứng là 100%. Vậy công thức của X là A. CH3CHO. B. CH2(CHO)2. C. OHC-CHO. D. C2H4(CHO)2. >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 12/18 Giải: Chênh lệch khối lượng chính mà mO = 4,5 - 2,9 = 1,6 => nO = 0,1 Xét trường hợp X đơn chức: MX = 29 => không thỏa mãn VỚi X có 2 chức, nX = 0,1 : 2 = 0,05 mol => MX = 58 => Đáp án C Câu 28: Hỗn hợp X gồm: HCHO, CH3COOH, HCOOCH3 và CH3CH(OH)COOH. Đốt cháy hoàn toàn hỗn hợp X cần V lít O2 (đktc) sau phản ứng thu được CO2 và H2O. Hấp thụ hết sản phẩm cháy vào nước vôi trong dư thu được 30 gam kết tủa. Vậy giá trị của V tương ứng là A. 5,60 lít. B. 8,40 lít. C. 7,84 lít. D. 6,72 lít. Giải: Vì nH2O = nCO2 = 0,3 mol X có dạng (CH2O)n => nO = nC = 0,3 =>V = 0,3.22.4 = 6,72 l => Đáp án D Câu 29: Glucozơ tác dụng được với tất cả các chất trong nhóm nào sau đây? A. H2 (đk thường), Cu(OH)2, O2. B. Na, CaCO3, H2 (Ni, to). C. Ag, CuO, CH3COOH. D. H2(Ni, to), Cu(OH)2 (trong nước), AgNO3 (NH3,to). Giải: ý B loại CaCO3 ý C loại Ag, CuO Còn ý A và ý D, xét thấy điều kiện Cu(OH)2 trong nước thỏa mãn hơn => Đáp án D Câu 30: Cho 2,74 gam Ba vào 100 ml dung dịch hỗn hợp HCl 0,2M và CuSO4 0,3M thu được m gam kết tủa. Giá trị của m là A. 1,96. B. 4,66. C. 2,94. D. 5,64. Giải: Ta có nBa(OH)2 = 0,02; HCl 0,01 mol => Sau phản ứng có 0,01 mol Cu(OH)2 và 0,02 mol BaSO4 => m =5,64 gam => Đáp án D Câu 31: Cho dung dịch NaOH dư vào 100 ml dung dịch chứa đồng thời Ba(HCO3)2 0,5 M và BaCl2 0,4 M. Khố i lươ ̣ng kế t tủa thu đươ ̣c là A. 19,7 gam. B. 29,55 gam. C. 23,64 gam. D. 17,73 gam. Giải: Tổng số mol Ba2+ = 0,09 (mol) >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 13/18 Tổng số mol HCO3- = 0,1 (mol) Vì OH- dư ==> Toàn bộ HCO3- tạo thành (CO3)2Ba2+ + CO3 --> BaCO3 0,09 --------------> 0,09 m kết tủa = 17,73g => Đáp án D Câu 32: Chất X có CTPT C4H8O2. Khi cho X tác dụng với ddNaOH (to) thì thu được chất Y có công thức C2H3O2Na. Công thức cấu tạo của chất X là A. C2H5COOCH3. B. CH3COOC2H5. C. HCOOC3H7. D. HCOOC3H5. Giải: Y có công thức là CH3COONa => X là CH3COOC2H5. => Đáp án B Câu 33: Thực hiện các thí nghiệm sau: - Thí nghiệm 1: Trộn 0,015 mol ancol no X với 0,02 mol ancol no Y rồi cho hỗn hợp tác dụng hết với Na được 1,008 lít H2. - Thí nghiệm 2: Trộn 0,02 mol ancol X với 0,015 mol ancol Y rồi cho hỗn hợp tác dụng hết với Na được 0,952 lít H2. - Thí nghiệm 3: Đốt cháy hoàn toàn một lượng hỗn hợp ancol như trong thí nghiệm 1 thu được 6,21 gam hỗn hợp gồm CO2 và H2O. Biết thể tích các khi đo ở đktc và các ancol đều mạch hở. Công thức 2 ancol X và Y lần lượt là A. C2H4(OH)2 và C3H5(OH)3. B. C2H5OH và C3H7OH. C. C3H6(OH)2 và C3H5(OH)3. D. CH3OH và C2H5OH. Giải: Thí nghiệm 1: R(OH)x +Na = x/2H2 0,015...............0,015x/2 R(OH)y = Na = y/2H2 0,02................0,02y/2 pt1: 0,015x/2 + 0,02y = 0,045 Thí nghiệm 2: phương trình tương tự như thí nghiệm 1 pt2: 0,02x/2 + 0,015y/2 = 0,0425 Từ hai phương trình trên suy ra x = 2 và y = 3 Thí nghiệm 3: (ancol no) X: CnH2n+2O2 + O2 = nCO2 + (n+1)H2O Y: CmH2m+2O3 + O2 = mCO2 + (m+1)H2O Ta có: 44(0,015n+0,02m) + 18(0,015n + 0,02m + 0,035) = 6,21 <=> 0,93n + 1,24m = 5,58 => n = 2 và m = 3 >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 14/18 => Đáp án A Câu 34: Hỗn hợp X gồm 2 axit cacboxylic no, mạch hở. Đốt cháy hoàn toàn a mol hỗn hợp X thu được a mol H2O. Mặt khác, cho a mol hỗn hợp X tác dụng với NaHCO3 thu được 1,4a mol CO2. % khối lượng của axit có phân tử khối nhỏ hơn trong hỗn hợp X là A. 35,8%. B. 43,4%. C. 26,4%. D. 27,3%. Giải: Dễ thấy cả 2 axit đều có 2 H => HCOOH và HOOC-COOH Đặt số mol 2 chất là x và y, đặt a = 1 thì x+y=1 x + 2y = 1,4 => x = 0,6; y = 0,4 => % m HCOOH = 43,4% => Đáp án B Câu 35: Ứng dụng nào sau đây không phải của thạch cao nung (CaSO4.H2O)? A. Bó bột khi gẫy xương. B. Đúc khuôn. C. Thức ăn cho người và đô ̣ng vâ ̣t. D. Nă ̣n tươ ̣ng. Giải: Đáp án C sai vì thạch cao không ăn được => Đáp án C Câu 36: Phát biểu nào sau đây là sai ? A. CaOCl2 là muối kép. B. Liên kết kim loại là liên kết được hình thành giữa các nguyên tử và ion kim loại trong mạng tinh thể do sự tham gia của các electron tự do. C. Supephotphat kép có thành phần chủ yếu là Ca(H2PO4)2. D. Trong các HX (X: halogen) thì HF có tính axit yếu nhất. Giải: ý A sai, CaOCl2 là muối hỗn tạp, còn muối kép là muối kết tinh từ dung dịch hỗn hợp hai muối đơn giản. => Đáp án A Câu 37: Cho 0,1 mol α-amino axit X tác dụng vừa đủ với 50 ml dung dịch HCl 2M. Trong một thí nghiệm khác, cho 26,7 gam X vào dung dịch HCl dư, sau đó cô cạn cẩn thận dung dịch thu được 37,65 gam muối khan. Vậy X là A. Alanin. B. Valin. C. Glyxin. D. Axit glutamic. Giải: Ta có nHC l = 0.05.2 = 0.1 (mol) 0,1 mol α-amino axit X tác dụng vừa đủ với 50 ml dung dịch HCl 2M => X chỉ chứa 1 nhóm -NH2 26,7 gam X tác dụng vớidung dịch HCl dư -> 37,65 gam muối => nHCl=(37.65-26.7)/36.5 = 0.3(mol) Suy ra: MX = 26.7/0.3= 89 => X cũng chỉ chứa 1 nhóm –COOH >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 15/18 Gọi X là NH2-R-COOH => R+ 61=89 => R=28 (C2H4=) X là α-amino axit nên CTCT X: CH3-CH(NH2)-COOH => alanin => Đáp án A Câu 38: Thể tích dd NaOH 2M tối thiểu để hấp thụ hết 5,6 lít khí CO2 (đktc) là A. 500 ml. B. 175 ml. C. 125 ml. D. 250 ml. Giải: Tối thiểu => tỉ lệ 1:1 => V = 0,25:2 = 125 ml => Đáp án C Câu 39: Este nào sau đây có mùi thơm của hoa nhài ? A. etyl axetat. B. benzyl axetat. C. isoamyl axetat. Giải: D. phenyl axetat. Este có mùi hoa nhài là benzyl axetatCH3–COOCH2C6H5 => Đáp án B Câu 40: Nhúng một lá sắt nhỏ vào dd chứa một trong những chất sau: FeCl3, AlCl3, CuSO4, Pb(NO3)2, NaCl, HNO3 (loãng, dư), H2SO4 (đặc, nóng, dư), NH4NO3, AgNO3 thiếu. Số trường hợp phản ứng tạo muối Fe(II) là A. 3. B. 4. C. 5. D. 6. Giải: Các dung dịch tạo được muối sắt II là: FeCl3, CuSO4, Pb(NO3)2 => Đáp án A Câu 41: Cho một đipeptit Y có công thức phân tử C6H12N2O3. Số đồng phân peptit của Y (chỉ chứa gốc αamino axit) mạch hở là A. 7. B. 5. C. 4. D. 6. Giải: Công thức đipeptit là NH2-CH(R1)-CO-NH-CH(R2)-COOH Trong đó đã có C4H6N2O3 =>tổng của R1 và R2 là C2H6 (R1,R2)gồm (H,C2H5), (CH3,CH3), (C2H5,H)=> 3dp mà C2H5 tạo với CH mạch thẳng và mạch nhánh => 2dp nữa Vậy có 5 đồng phân => Đáp án B Câu 42: Chấ t nào sau đây không tác dụng với dung dịch HCl? A. Al. B. KMnO4. C. Cu(OH)2. Giải: D. Ag. vì Ag đứng sau H trong dãy điện hóa nên Ag không tác dụng với HCl => Đáp án D Câu 43: Dãy gồm tất cả các chất đều hoà tan trong dung dịch HCl dư là A. Mg, BaSO4, Fe3O4. B. Al(OH)3, AgCl, CuO. >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 16/18 C. CuS, (NH4)2SO4, KOH. Giải: D. KMnO4, KCl, FeCO3. ý A loại BaSO4; ý B loại AgCl; ý C loại CuS (chú ý đề bài nói hòa tan trong dung dịch chứ không hỏi phản ứng!) => Đáp án D Câu 44: Cho các dung dich ̣ sau: NaHCO3, NaHSO4, AlCl3, Na3PO4, AgNO3, HNO3. Chất tác dụng được với nhiều chất nhất trong số các chất cho ở trên là A. HCl. B. BaCl2. C. H2SO4. D. NaOH. Giải: Để ý NaHCO3, NaHSO4 lưỡng tính AlCl3 và HNO3 có tính axit Na3PO4, AgNO3 là muối => Một bazo sẽ phản ứng được với nhiều chất nhất so với axit hoặc muối khác => Đáp án D Câu 45: Có thể dùng NaOH (ở thể rắn) để làm khô các chất khí nào sau đây? A. NH3, O2, N2, CH4, H2. B. NH3, SO2, CO, Cl2. C. N2, NO2, CO2, CH4, H2. D. N2, Cl2, O2, CO2, H2. Giải: NaOH là axit, làm khô chất tức là không tác dụng với nó, ở đây loại các oxit axit CO2, SO2 => Đáp án A Câu 46: Cho hình vẽ như sau: Hiện tượng xảy ra trong bình eclen chứa ddBr2 là A. Có kết tủa xuất hiện. B. Dung dịch Br2 bị mất màu. C. Vừa có kết tủa vừa mất màu dung dịch Br2. D. Không có phản ứng xảy ra. dd H2SO4 đặc Na2SO3 dd Br2 tt Giải: Đáp án B: Ở đây có phản ứng giữa: H+ + SO32-  H2O + SO2 Sau đó: SO2 làm mất màu dung dịch Br2 Câu 47: Etylamin không có tính chất nào sau đây? A. Tác dụng với ddHCl. B. Tác dụng với ddFeCl3. C. Làm đổi màu quỳ tím ẩm. D. Tác dụng với CaCO3. Giải: Etylamin có tính bazo, không tác dụng với CaCO3 => Đáp án D Câu 48: Điện phân với điện cực trơ dung dịch chứa 0,3 mol AgNO3 bằng cường độ dòng điện 2,68 ampe, trong thời gian t giờ thu được dung dịch X. Cho 22,4 gam bột Fe vào dung dịch X thấy thoát ra khí NO (sản phẩm khử duy nhất) thu được 34,28 gam chất rắn. Các phản ứng xảy ra hoàn toàn. Giá trị của t là >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 17/18 A. 1,25. Giải: B. 1,0. C. 1,2. D. 1,4. 2AgNO3 + H2O --> 2Ag + 2HNO3 + 1/2O2 x -----------------------------------> x Vì kim loại chất rắn sau phản ứng tăng nên AgNO3 còn dư (0.3 - x) mol Fe + 4HNO3 --> Fe(NO3)3 + NO + 2H2O x/4<---x -----------> x/4 Fe + 2Fe(NO3)3 --> 3Fe(NO3)2 x/8 <--- x/4 Fe + 2AgNO3 --> Fe(NO3)2 + 2Ag (0.3-x)/2<--(0.3-x) --------------------> 0.3-x m sau = 22.4 - 56(x/4 + x/8 + 0.15 - x/2) + 108(0.3-x) = 34.28 --> x = 0.12 --> t = 0.12*96500/2.68 = 4320 (s) = 1.2h => Đáp án C Câu 49: Phát biểu nào sau đây đúng? A. Tất cả các nguyên tố thuộc nhóm B đều là kim loại. B. Tất cả các nguyên tố thuộc nhóm A đều là kim loại. C. Nguyên tử các nguyên tố có 1, 2, 3 electron lớp ngoài cùng đều là kim loại. D. Nguyên tử các nguyên tố có 5, 6, 7 electron lớp ngoài cùng đều là kim loại. Giải: ý B và D rõ ràng sai, ý C sai vì có He => Đáp án A Câu 50: Trộn lẫn dung dịch có chứa 100 gam H3PO4 14,7% với dung dịch 16,8 gam KOH. Khối lượng muối thu được trong dung dịch là A. 28,8 gam. B. 31,5 gam. C. 26,1 gam. D. 14,7 gam. Giải: Ta có nH3PO4 = 0,15 mol và nKOH = 0,3 mol => sau phản ứng tạo ra 0,15 mol K2HPO4 có m = 26,1 gam => Đáp án C ----------- HẾT ---------- >>Để xem lời giải chi tiết của từng câu, truy cập trang http://tuyensinh247.com/ và nhập mã ID câu. 18/18
- Xem thêm -